C17H21NO — CID 91038848
N-(2-tricyclo[5.2.1.02,6]decanyl)benzamide (PubChem CID 91038848) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is N-(2-tricyclo[5.2.1.02,6]decanyl)benzamide.
| Compound Name | N-(2-tricyclo[5.2.1.02,6]decanyl)benzamide |
|---|---|
| PubChem CID | 91038848 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-(2-tricyclo[5.2.1.02,6]decanyl)benzamide |
| SMILES | O=C(NC12CCCC1C1CCC2C1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO/c19-16(12-5-2-1-3-6-12)18-17-10-4-7-15(17)13-8-9-14(17)11-13/h1-3,5-6,13-15H,4,7-11H2,(H,18,19) |
| InChIKey | GDKUWSPHESBVRJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |