C19H25NO2 — CID 167144822
benzyl N-[(1S,8R)-2-tricyclo[6.2.1.02,7]undecanyl]carbamate (PubChem CID 167144822) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is benzyl N-[(1S,8R)-2-tricyclo[6.2.1.02,7]undecanyl]carbamate.
| Compound Name | benzyl N-[(1S,8R)-2-tricyclo[6.2.1.02,7]undecanyl]carbamate |
|---|---|
| PubChem CID | 167144822 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | benzyl N-[(1S,8R)-2-tricyclo[6.2.1.02,7]undecanyl]carbamate |
| SMILES | O=C(NC12CCCCC1[C@@H]1CC[C@H]2C1)OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c21-18(22-13-14-6-2-1-3-7-14)20-19-11-5-4-8-17(19)15-9-10-16(19)12-15/h1-3,6-7,15-17H,4-5,8-13H2,(H,20,21)/t15-,16+,17?,19?/m1/s1 |
| InChIKey | NKQFPXFPAOKDGC-INECWFNRSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |