C18H21NO6 — CID 10617631
dimethyl (1S,2S,4S,5S)-2-(phenylmethoxycarbonylamino)bicyclo[2.1.1]hexane-2,5-dicarboxylate (PubChem CID 10617631) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is dimethyl (1S,2S,4S,5S)-2-(phenylmethoxycarbonylamino)bicyclo[2.1.1]hexane-2,5-dicarboxylate.
| Compound Name | dimethyl (1S,2S,4S,5S)-2-(phenylmethoxycarbonylamino)bicyclo[2.1.1]hexane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 10617631 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | dimethyl (1S,2S,4S,5S)-2-(phenylmethoxycarbonylamino)bicyclo[2.1.1]hexane-2,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C[C@@H]1[C@](NC(=O)OCc1ccccc1)(C(=O)OC)C2 |
| InChI | InChI=1S/C18H21NO6/c1-23-15(20)14-12-8-13(14)18(9-12,16(21)24-2)19-17(22)25-10-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3,(H,19,22)/t12-,13-,14-,18-/m0/s1 |
| InChIKey | KBEAUQULSOAZFJ-NUXNZHGMSA-N |
| XLogP | 1.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|