C21H25NO6 — CID 86691272
diethyl (1S,2S,5R,6S)-4-methylidene-2-(phenylmethoxycarbonylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 86691272) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is diethyl (1S,2S,5R,6S)-4-methylidene-2-(phenylmethoxycarbonylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1S,2S,5R,6S)-4-methylidene-2-(phenylmethoxycarbonylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 86691272 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | diethyl (1S,2S,5R,6S)-4-methylidene-2-(phenylmethoxycarbonylamino)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | C=C1C[C@@](NC(=O)OCc2ccccc2)(C(=O)OCC)[C@H]2[C@@H]1[C@@H]2C(=O)OCC |
| InChI | InChI=1S/C21H25NO6/c1-4-26-18(23)16-15-13(3)11-21(17(15)16,19(24)27-5-2)22-20(25)28-12-14-9-7-6-8-10-14/h6-10,15-17H,3-5,11-12H2,1-2H3,(H,22,25)/t15-,16-,17-,21-/m0/s1 |
| InChIKey | XFXBGQXNTKLSKT-IAGYGMIVSA-N |
| XLogP | 2.60 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|