C26H34N2O7 — CID 142165132
diethyl 4-[2-(benzylamino)-2-oxoethylidene]-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 142165132) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is diethyl 4-[2-(benzylamino)-2-oxoethylidene]-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl 4-[2-(benzylamino)-2-oxoethylidene]-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 142165132 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | diethyl 4-[2-(benzylamino)-2-oxoethylidene]-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)C1C2C(=CC(=O)NCc3ccccc3)CC(NC(=O)OC(C)(C)C)(C(=O)OCC)C12 |
| InChI | InChI=1S/C26H34N2O7/c1-6-33-22(30)20-19-17(13-18(29)27-15-16-11-9-8-10-12-16)14-26(21(19)20,23(31)34-7-2)28-24(32)35-25(3,4)5/h8-13,19-21H,6-7,14-15H2,1-5H3,(H,27,29)(H,28,32) |
| InChIKey | GCQPBEIPFIHTMG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|