C25H34N2O7 — CID 90850940
diethyl (1S,2R,4S,5S,6R)-4-(2-anilino-2-oxoethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 90850940) has the molecular formula C25H34N2O7 and a molecular weight of 474.55 g/mol. Its IUPAC name is diethyl (1S,2R,4S,5S,6R)-4-(2-anilino-2-oxoethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1S,2R,4S,5S,6R)-4-(2-anilino-2-oxoethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 90850940 |
| Molecular Formula | C25H34N2O7 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | diethyl (1S,2R,4S,5S,6R)-4-(2-anilino-2-oxoethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2[C@H](CC(=O)Nc3ccccc3)C[C@](NC(=O)OC(C)(C)C)(C(=O)OCC)[C@H]12 |
| InChI | InChI=1S/C25H34N2O7/c1-6-32-21(29)19-18-15(13-17(28)26-16-11-9-8-10-12-16)14-25(20(18)19,22(30)33-7-2)27-23(31)34-24(3,4)5/h8-12,15,18-20H,6-7,13-14H2,1-5H3,(H,26,28)(H,27,31)/t15-,18-,19-,20+,25-/m1/s1 |
| InChIKey | WOFVVHAOHSBAPF-YARHTUHMSA-N |
| XLogP | 3.29 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|