C20H31NO8 — CID 90850311
diethyl (1S,2R,4S,5S,6R)-4-(2-methoxy-2-oxoethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 90850311) has the molecular formula C20H31NO8 and a molecular weight of 413.47 g/mol. Its IUPAC name is diethyl (1S,2R,4S,5S,6R)-4-(2-methoxy-2-oxoethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1S,2R,4S,5S,6R)-4-(2-methoxy-2-oxoethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 90850311 |
| Molecular Formula | C20H31NO8 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | diethyl (1S,2R,4S,5S,6R)-4-(2-methoxy-2-oxoethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2[C@H](CC(=O)OC)C[C@](NC(=O)OC(C)(C)C)(C(=O)OCC)[C@H]12 |
| InChI | InChI=1S/C20H31NO8/c1-7-27-16(23)14-13-11(9-12(22)26-6)10-20(15(13)14,17(24)28-8-2)21-18(25)29-19(3,4)5/h11,13-15H,7-10H2,1-6H3,(H,21,25)/t11-,13-,14-,15+,20-/m1/s1 |
| InChIKey | GXXQCYLKKBLEDF-CNRBYCSHSA-N |
| XLogP | 1.82 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|