C22H34N2O9 — CID 71122155
ethyl (1R,2S,4S,5S,6R)-4-acetyloxy-6-(2-methoxy-2-oxoethyl)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]bicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 71122155) has the molecular formula C22H34N2O9 and a molecular weight of 470.52 g/mol. Its IUPAC name is ethyl (1R,2S,4S,5S,6R)-4-acetyloxy-6-(2-methoxy-2-oxoethyl)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]bicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | ethyl (1R,2S,4S,5S,6R)-4-acetyloxy-6-(2-methoxy-2-oxoethyl)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]bicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 71122155 |
| Molecular Formula | C22H34N2O9 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | ethyl (1R,2S,4S,5S,6R)-4-acetyloxy-6-(2-methoxy-2-oxoethyl)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]bicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(NC(=O)[C@H](C)NC(=O)OC(C)(C)C)C[C@H](OC(C)=O)[C@H]2[C@H](CC(=O)OC)[C@H]21 |
| InChI | InChI=1S/C22H34N2O9/c1-8-31-19(28)22(24-18(27)11(2)23-20(29)33-21(4,5)6)10-14(32-12(3)25)16-13(17(16)22)9-15(26)30-7/h11,13-14,16-17H,8-10H2,1-7H3,(H,23,29)(H,24,27)/t11-,13-,14-,16+,17+,22-/m0/s1 |
| InChIKey | BPBBMZXPZIKNMN-PDQNEULJSA-N |
| XLogP | 1.08 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|