C23H36N2O8 — CID 59712869
6-O-ethenyl 2-O-ethyl (1S,2S,4S,5R,6R)-4-hydroxy-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 59712869) has the molecular formula C23H36N2O8 and a molecular weight of 468.55 g/mol. Its IUPAC name is 6-O-ethenyl 2-O-ethyl (1S,2S,4S,5R,6R)-4-hydroxy-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | 6-O-ethenyl 2-O-ethyl (1S,2S,4S,5R,6R)-4-hydroxy-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 59712869 |
| Molecular Formula | C23H36N2O8 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 6-O-ethenyl 2-O-ethyl (1S,2S,4S,5R,6R)-4-hydroxy-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | C=COC(=O)[C@H]1[C@H]2[C@@H]1[C@](NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C)(C(=O)OCC)C[C@@H]2O |
| InChI | InChI=1S/C23H36N2O8/c1-8-31-19(28)16-15-14(26)11-23(17(15)16,20(29)32-9-2)25-18(27)13(10-12(3)4)24-21(30)33-22(5,6)7/h8,12-17,26H,1,9-11H2,2-7H3,(H,24,30)(H,25,27)/t13-,14-,15-,16-,17-,23-/m0/s1 |
| InChIKey | PXGCYCRTTOCPBG-BOVDKCABSA-N |
| XLogP | 1.66 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|