C22H32N2O8 — CID 140550607
6-O-ethenyl 2-O-ethyl (1S,4S,5R,6R)-4-hydroxy-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 140550607) has the molecular formula C22H32N2O8 and a molecular weight of 452.50 g/mol. Its IUPAC name is 6-O-ethenyl 2-O-ethyl (1S,4S,5R,6R)-4-hydroxy-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | 6-O-ethenyl 2-O-ethyl (1S,4S,5R,6R)-4-hydroxy-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 140550607 |
| Molecular Formula | C22H32N2O8 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 6-O-ethenyl 2-O-ethyl (1S,4S,5R,6R)-4-hydroxy-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | C=COC(=O)[C@H]1[C@H]2[C@@H]1C(NC(=O)C1CCCN1C(=O)OC(C)(C)C)(C(=O)OCC)C[C@@H]2O |
| InChI | InChI=1S/C22H32N2O8/c1-6-30-18(27)15-14-13(25)11-22(16(14)15,19(28)31-7-2)23-17(26)12-9-8-10-24(12)20(29)32-21(3,4)5/h6,12-16,25H,1,7-11H2,2-5H3,(H,23,26)/t12?,13-,14-,15-,16-,22?/m0/s1 |
| InChIKey | YWDTYOVWNLJHEP-UCWHYVNUSA-N |
| XLogP | 1.12 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|