C18H28N4O5 — CID 123250101
tert-butyl N-[2-[2-[(1-carbamoyl-2-ethenylcyclopropyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 123250101) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(1-carbamoyl-2-ethenylcyclopropyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(1-carbamoyl-2-ethenylcyclopropyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 123250101 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | tert-butyl N-[2-[2-[(1-carbamoyl-2-ethenylcyclopropyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | C=CC1CC1(NC(=O)C1CCCN1C(=O)CNC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C18H28N4O5/c1-5-11-9-18(11,15(19)25)21-14(24)12-7-6-8-22(12)13(23)10-20-16(26)27-17(2,3)4/h5,11-12H,1,6-10H2,2-4H3,(H2,19,25)(H,20,26)(H,21,24) |
| InChIKey | FWORDMACFQYUCJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|