C27H50N4O7S — CID 143117458
tert-butyl N-[2-(2-carbamoylpyrrolidin-1-yl)-2-oxoethyl]carbamate;N-cyclopropylsulfonylpentanamide;hept-1-ene (PubChem CID 143117458) has the molecular formula C27H50N4O7S and a molecular weight of 574.79 g/mol. Its IUPAC name is tert-butyl N-[2-(2-carbamoylpyrrolidin-1-yl)-2-oxoethyl]carbamate;N-cyclopropylsulfonylpentanamide;hept-1-ene.
| Compound Name | tert-butyl N-[2-(2-carbamoylpyrrolidin-1-yl)-2-oxoethyl]carbamate;N-cyclopropylsulfonylpentanamide;hept-1-ene |
|---|---|
| PubChem CID | 143117458 |
| Molecular Formula | C27H50N4O7S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | tert-butyl N-[2-(2-carbamoylpyrrolidin-1-yl)-2-oxoethyl]carbamate;N-cyclopropylsulfonylpentanamide;hept-1-ene |
| SMILES | C=CCCCCC.CC(C)(C)OC(=O)NCC(=O)N1CCCC1C(N)=O.CCCCC(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C12H21N3O4.C8H15NO3S.C7H14/c1-12(2,3)19-11(18)14-7-9(16)15-6-4-5-8(15)10(13)17;1-2-3-4-8(10)9-13(11,12)7-5-6-7;1-3-5-7-6-4-2/h8H,4-7H2,1-3H3,(H2,13,17)(H,14,18);7H,2-6H2,1H3,(H,9,10);3H,1,4-7H2,2H3 |
| InChIKey | GUSGJJOLBRYBES-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|