C14H23N3O5 — CID 143329849
tert-butyl N-[2-[(2S,4R)-2-carbamoyl-4-ethenyl-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 143329849) has the molecular formula C14H23N3O5 and a molecular weight of 313.35 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S,4R)-2-carbamoyl-4-ethenyl-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2S,4R)-2-carbamoyl-4-ethenyl-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 143329849 |
| Molecular Formula | C14H23N3O5 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | tert-butyl N-[2-[(2S,4R)-2-carbamoyl-4-ethenyl-4-hydroxypyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | C=C[C@]1(O)C[C@@H](C(N)=O)N(C(=O)CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H23N3O5/c1-5-14(21)6-9(11(15)19)17(8-14)10(18)7-16-12(20)22-13(2,3)4/h5,9,21H,1,6-8H2,2-4H3,(H2,15,19)(H,16,20)/t9-,14-/m0/s1 |
| InChIKey | VBWBKOCILKDKQO-XPTSAGLGSA-N |
| XLogP | -0.49 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|