C21H36N4O6S2 — CID 53345993
tert-butyl N-[2-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]carbamate (PubChem CID 53345993) has the molecular formula C21H36N4O6S2 and a molecular weight of 504.68 g/mol. Its IUPAC name is tert-butyl N-[2-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 53345993 |
| Molecular Formula | C21H36N4O6S2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | tert-butyl N-[2-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CC2(C[C@H]1C(=O)NCCCCCCC(=O)NO)SCCS2 |
| InChI | InChI=1S/C21H36N4O6S2/c1-20(2,3)31-19(29)23-13-17(27)25-14-21(32-10-11-33-21)12-15(25)18(28)22-9-7-5-4-6-8-16(26)24-30/h15,30H,4-14H2,1-3H3,(H,22,28)(H,23,29)(H,24,26)/t15-/m0/s1 |
| InChIKey | XWYYHIIPDBZAJA-HNNXBMFYSA-N |
| XLogP | 1.86 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|