C24H40N4O6S2 — CID 53345882
tert-butyl (2S)-2-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonane-7-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 53345882) has the molecular formula C24H40N4O6S2 and a molecular weight of 544.74 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonane-7-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonane-7-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 53345882 |
| Molecular Formula | C24H40N4O6S2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | tert-butyl (2S)-2-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonane-7-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)N1CC2(C[C@H]1C(=O)NCCCCCCC(=O)NO)SCCS2 |
| InChI | InChI=1S/C24H40N4O6S2/c1-23(2,3)34-22(32)27-12-8-9-17(27)21(31)28-16-24(35-13-14-36-24)15-18(28)20(30)25-11-7-5-4-6-10-19(29)26-33/h17-18,33H,4-16H2,1-3H3,(H,25,30)(H,26,29)/t17-,18-/m0/s1 |
| InChIKey | DLPLBSWBPDCEBQ-ROUUACIJSA-N |
| XLogP | 2.74 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|