C30H53N5O8S2 — CID 53346096
tert-butyl N-[(2S)-1-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate (PubChem CID 53346096) has the molecular formula C30H53N5O8S2 and a molecular weight of 675.92 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 53346096 |
| Molecular Formula | C30H53N5O8S2 |
| Molecular Weight | 675.92 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2(C[C@H]1C(=O)NCCCCCCC(=O)NO)SCCS2 |
| InChI | InChI=1S/C30H53N5O8S2/c1-28(2,3)42-26(39)32-16-12-10-13-21(33-27(40)43-29(4,5)6)25(38)35-20-30(44-17-18-45-30)19-22(35)24(37)31-15-11-8-7-9-14-23(36)34-41/h21-22,41H,7-20H2,1-6H3,(H,31,37)(H,32,39)(H,33,40)(H,34,36)/t21-,22-/m0/s1 |
| InChIKey | ZNHUNVDHKXXPSN-VXKWHMMOSA-N |
| XLogP | 3.92 |
| TPSA | 175.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|