C16H28N2O5S2 — CID 101267632
(2S)-6-[(2-methyl-1,3-dithiolane-2-carbonyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 101267632) has the molecular formula C16H28N2O5S2 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2S)-6-[(2-methyl-1,3-dithiolane-2-carbonyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-6-[(2-methyl-1,3-dithiolane-2-carbonyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 101267632 |
| Molecular Formula | C16H28N2O5S2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (2S)-6-[(2-methyl-1,3-dithiolane-2-carbonyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)C1(C)SCCS1)C(=O)O |
| InChI | InChI=1S/C16H28N2O5S2/c1-15(2,3)23-14(22)18-11(12(19)20)7-5-6-8-17-13(21)16(4)24-9-10-25-16/h11H,5-10H2,1-4H3,(H,17,21)(H,18,22)(H,19,20)/t11-/m0/s1 |
| InChIKey | ZXOWAOHAEHEXPC-NSHDSACASA-N |
| XLogP | 2.45 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|