C17H30N4O4S2 — CID 53346308
(8S)-7-(3-aminopropanoyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide (PubChem CID 53346308) has the molecular formula C17H30N4O4S2 and a molecular weight of 418.59 g/mol. Its IUPAC name is (8S)-7-(3-aminopropanoyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide.
| Compound Name | (8S)-7-(3-aminopropanoyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 53346308 |
| Molecular Formula | C17H30N4O4S2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (8S)-7-(3-aminopropanoyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
| SMILES | NCCC(=O)N1CC2(C[C@H]1C(=O)NCCCCCCC(=O)NO)SCCS2 |
| InChI | InChI=1S/C17H30N4O4S2/c18-7-6-15(23)21-12-17(26-9-10-27-17)11-13(21)16(24)19-8-4-2-1-3-5-14(22)20-25/h13,25H,1-12,18H2,(H,19,24)(H,20,22)/t13-/m0/s1 |
| InChIKey | BZQLHUVQGXZMCB-ZDUSSCGKSA-N |
| XLogP | 0.68 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|