C20H37ClN4O4S2 — CID 53346201
(8S)-7-[(2S)-2-amino-4-methylpentanoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide;hydrochloride (PubChem CID 53346201) has the molecular formula C20H37ClN4O4S2 and a molecular weight of 497.13 g/mol. Its IUPAC name is (8S)-7-[(2S)-2-amino-4-methylpentanoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide;hydrochloride.
| Compound Name | (8S)-7-[(2S)-2-amino-4-methylpentanoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 53346201 |
| Molecular Formula | C20H37ClN4O4S2 |
| Molecular Weight | 497.13 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (8S)-7-[(2S)-2-amino-4-methylpentanoyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N1CC2(C[C@H]1C(=O)NCCCCCCC(=O)NO)SCCS2.Cl |
| InChI | InChI=1S/C20H36N4O4S2.ClH/c1-14(2)11-15(21)19(27)24-13-20(29-9-10-30-20)12-16(24)18(26)22-8-6-4-3-5-7-17(25)23-28;/h14-16,28H,3-13,21H2,1-2H3,(H,22,26)(H,23,25);1H/t15-,16-;/m0./s1 |
| InChIKey | XIIWFDSTHFVUCE-MOGJOVFKSA-N |
| XLogP | 2.13 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|