C20H34N4O4S2 — CID 53346314
(8S)-N-[7-(hydroxyamino)-7-oxoheptyl]-7-(piperidine-4-carbonyl)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide (PubChem CID 53346314) has the molecular formula C20H34N4O4S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is (8S)-N-[7-(hydroxyamino)-7-oxoheptyl]-7-(piperidine-4-carbonyl)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide.
| Compound Name | (8S)-N-[7-(hydroxyamino)-7-oxoheptyl]-7-(piperidine-4-carbonyl)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 53346314 |
| Molecular Formula | C20H34N4O4S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (8S)-N-[7-(hydroxyamino)-7-oxoheptyl]-7-(piperidine-4-carbonyl)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
| SMILES | O=C(CCCCCCNC(=O)[C@@H]1CC2(CN1C(=O)C1CCNCC1)SCCS2)NO |
| InChI | InChI=1S/C20H34N4O4S2/c25-17(23-28)5-3-1-2-4-8-22-18(26)16-13-20(29-11-12-30-20)14-24(16)19(27)15-6-9-21-10-7-15/h15-16,21,28H,1-14H2,(H,22,26)(H,23,25)/t16-/m0/s1 |
| InChIKey | OYEWVECHPVGKDR-INIZCTEOSA-N |
| XLogP | 1.34 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|