C18H32N4O4S2 — CID 53346310
(8S)-7-(4-aminobutanoyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide (PubChem CID 53346310) has the molecular formula C18H32N4O4S2 and a molecular weight of 432.61 g/mol. Its IUPAC name is (8S)-7-(4-aminobutanoyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide.
| Compound Name | (8S)-7-(4-aminobutanoyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 53346310 |
| Molecular Formula | C18H32N4O4S2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (8S)-7-(4-aminobutanoyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
| SMILES | NCCCC(=O)N1CC2(C[C@H]1C(=O)NCCCCCCC(=O)NO)SCCS2 |
| InChI | InChI=1S/C18H32N4O4S2/c19-8-5-7-16(24)22-13-18(27-10-11-28-18)12-14(22)17(25)20-9-4-2-1-3-6-15(23)21-26/h14,26H,1-13,19H2,(H,20,25)(H,21,23)/t14-/m0/s1 |
| InChIKey | GBNSJFIEWNJSKJ-AWEZNQCLSA-N |
| XLogP | 1.07 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|