C25H44N4O6S2 — CID 53346098
tert-butyl N-[(2R)-1-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 53346098) has the molecular formula C25H44N4O6S2 and a molecular weight of 560.78 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 53346098 |
| Molecular Formula | C25H44N4O6S2 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(8S)-8-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CC2(C[C@H]1C(=O)NCCCCCCC(=O)NO)SCCS2 |
| InChI | InChI=1S/C25H44N4O6S2/c1-17(2)14-18(27-23(33)35-24(3,4)5)22(32)29-16-25(36-12-13-37-25)15-19(29)21(31)26-11-9-7-6-8-10-20(30)28-34/h17-19,34H,6-16H2,1-5H3,(H,26,31)(H,27,33)(H,28,30)/t18-,19+/m1/s1 |
| InChIKey | HNZLEOUIFFOGFM-MOPGFXCFSA-N |
| XLogP | 3.28 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|