C22H34N2O8S — CID 59205463
6-O-ethenyl 2-O-ethyl (1S,2S,4S,5R,6R)-4-hydroxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 59205463) has the molecular formula C22H34N2O8S and a molecular weight of 486.59 g/mol. Its IUPAC name is 6-O-ethenyl 2-O-ethyl (1S,2S,4S,5R,6R)-4-hydroxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | 6-O-ethenyl 2-O-ethyl (1S,2S,4S,5R,6R)-4-hydroxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 59205463 |
| Molecular Formula | C22H34N2O8S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 6-O-ethenyl 2-O-ethyl (1S,2S,4S,5R,6R)-4-hydroxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | C=COC(=O)[C@H]1[C@H]2[C@@H]1[C@](NC(=O)[C@H](CCSC)NC(=O)OC(C)(C)C)(C(=O)OCC)C[C@@H]2O |
| InChI | InChI=1S/C22H34N2O8S/c1-7-30-18(27)15-14-13(25)11-22(16(14)15,19(28)31-8-2)24-17(26)12(9-10-33-6)23-20(29)32-21(3,4)5/h7,12-16,25H,1,8-11H2,2-6H3,(H,23,29)(H,24,26)/t12-,13-,14-,15-,16-,22-/m0/s1 |
| InChIKey | SFRLQRMWFXNGMK-AQWQEJKOSA-N |
| XLogP | 1.36 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|