C24H37N5O7S2 — CID 90131971
diethyl (1R,2S,4R,5R,6R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]-4-(2H-triazol-4-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 90131971) has the molecular formula C24H37N5O7S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is diethyl (1R,2S,4R,5R,6R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]-4-(2H-triazol-4-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1R,2S,4R,5R,6R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]-4-(2H-triazol-4-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 90131971 |
| Molecular Formula | C24H37N5O7S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | diethyl (1R,2S,4R,5R,6R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]-4-(2H-triazol-4-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2[C@@H]1[C@](NC(=O)[C@H](CCSC)NC(=O)OC(C)(C)C)(C(=O)OCC)C[C@H]2Sc1cn[nH]n1 |
| InChI | InChI=1S/C24H37N5O7S2/c1-7-34-20(31)17-16-14(38-15-12-25-29-28-15)11-24(18(16)17,21(32)35-8-2)27-19(30)13(9-10-37-6)26-22(33)36-23(3,4)5/h12-14,16-18H,7-11H2,1-6H3,(H,26,33)(H,27,30)(H,25,28,29)/t13-,14+,16-,17-,18-,24-/m0/s1 |
| InChIKey | SVJMCMMXDWBHFP-QPJHJJECSA-N |
| XLogP | 2.16 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|