C15H22ClN5O5S2 — CID 90098930
(1R,2S,4R,5R,6R)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-(2H-triazol-4-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride (PubChem CID 90098930) has the molecular formula C15H22ClN5O5S2 and a molecular weight of 451.96 g/mol. Its IUPAC name is (1R,2S,4R,5R,6R)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-(2H-triazol-4-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride.
| Compound Name | (1R,2S,4R,5R,6R)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-(2H-triazol-4-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 90098930 |
| Molecular Formula | C15H22ClN5O5S2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (1R,2S,4R,5R,6R)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-4-(2H-triazol-4-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)N[C@@]1(C(=O)O)C[C@@H](Sc2cn[nH]n2)[C@H]2[C@H](C(=O)O)[C@H]21.Cl |
| InChI | InChI=1S/C15H21N5O5S2.ClH/c1-26-3-2-6(16)12(21)18-15(14(24)25)4-7(27-8-5-17-20-19-8)9-10(11(9)15)13(22)23;/h5-7,9-11H,2-4,16H2,1H3,(H,18,21)(H,22,23)(H,24,25)(H,17,19,20);1H/t6-,7+,9-,10-,11-,15-;/m0./s1 |
| InChIKey | OHGIVJFIZHQVKE-DCTSMKCRSA-N |
| XLogP | 0.06 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |