C11H15N3O3S — CID 104908861
5-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]pyridine-2-carboxylic acid (PubChem CID 104908861) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 5-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104908861 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]pyridine-2-carboxylic acid |
| SMILES | CSCC[C@@H](N)C(=O)Nc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C11H15N3O3S/c1-18-5-4-8(12)10(15)14-7-2-3-9(11(16)17)13-6-7/h2-3,6,8H,4-5,12H2,1H3,(H,14,15)(H,16,17)/t8-/m1/s1 |
| InChIKey | IIPFVOGAPHYRPA-MRVPVSSYSA-N |
| XLogP | 0.80 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |