C5H13ClN2O2S — CID 87530289
2-amino-N-hydroxy-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 87530289) has the molecular formula C5H13ClN2O2S and a molecular weight of 200.69 g/mol. Its IUPAC name is 2-amino-N-hydroxy-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | 2-amino-N-hydroxy-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 87530289 |
| Molecular Formula | C5H13ClN2O2S |
| Molecular Weight | 200.69 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-amino-N-hydroxy-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCCC(N)C(=O)NO.Cl |
| InChI | InChI=1S/C5H12N2O2S.ClH/c1-10-3-2-4(6)5(8)7-9;/h4,9H,2-3,6H2,1H3,(H,7,8);1H |
| InChIKey | LBPPIYLEDXCWGG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.69 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|