C5H13Br2N3O2S — CID 158556159
(2S)-2-amino-4-methylsulfanylbutanehydrazide;bromo hypobromite (PubChem CID 158556159) has the molecular formula C5H13Br2N3O2S and a molecular weight of 339.05 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanehydrazide;bromo hypobromite.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanehydrazide;bromo hypobromite |
|---|---|
| PubChem CID | 158556159 |
| Molecular Formula | C5H13Br2N3O2S |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanehydrazide;bromo hypobromite |
| SMILES | BrOBr.CSCC[C@H](N)C(=O)NN |
| InChI | InChI=1S/C5H13N3OS.Br2O/c1-10-3-2-4(6)5(9)8-7;1-3-2/h4H,2-3,6-7H2,1H3,(H,8,9);/t4-;/m0./s1 |
| InChIKey | HQHZMAMDLQJALS-WCCKRBBISA-N |
| XLogP | 0.68 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|