C6H11N3OS — CID 79193616
(2S)-2-amino-N-cyano-4-methylsulfanylbutanamide (PubChem CID 79193616) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is (2S)-2-amino-N-cyano-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-cyano-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 79193616 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (2S)-2-amino-N-cyano-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NC#N |
| InChI | InChI=1S/C6H11N3OS/c1-11-3-2-5(8)6(10)9-4-7/h5H,2-3,8H2,1H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | QURLGHCWDGKIIH-YFKPBYRVSA-N |
| XLogP | -0.34 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|