C23H36N4O6S — CID 86716585
ditert-butyl (1R,2S,4S,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 86716585) has the molecular formula C23H36N4O6S and a molecular weight of 496.63 g/mol. Its IUPAC name is ditert-butyl (1R,2S,4S,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | ditert-butyl (1R,2S,4S,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 86716585 |
| Molecular Formula | C23H36N4O6S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | ditert-butyl (1R,2S,4S,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(C(=O)OC(C)(C)C)C[C@H](Sc2ncn[nH]2)[C@H]2[C@H](C(=O)OC(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C23H36N4O6S/c1-20(2,3)31-16(28)14-13-12(34-18-24-11-25-27-18)10-23(15(13)14,17(29)32-21(4,5)6)26-19(30)33-22(7,8)9/h11-15H,10H2,1-9H3,(H,26,30)(H,24,25,27)/t12-,13-,14-,15-,23-/m0/s1 |
| InChIKey | SPMPPHYTWYNVJE-JHFNDOPCSA-N |
| XLogP | 3.48 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|