C15H20N4O6S — CID 71029046
(1R,2S,4R,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 71029046) has the molecular formula C15H20N4O6S and a molecular weight of 384.41 g/mol. Its IUPAC name is (1R,2S,4R,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,4R,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 71029046 |
| Molecular Formula | C15H20N4O6S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (1R,2S,4R,5R,6R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(C(=O)O)C[C@@H](Sc2ncn[nH]2)[C@H]2[C@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C15H20N4O6S/c1-14(2,3)25-13(24)18-15(11(22)23)4-6(26-12-16-5-17-19-12)7-8(9(7)15)10(20)21/h5-9H,4H2,1-3H3,(H,18,24)(H,20,21)(H,22,23)(H,16,17,19)/t6-,7+,8+,9+,15+/m1/s1 |
| InChIKey | KZULESKPDOSALY-VZEGPTIQSA-N |
| XLogP | 0.96 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |