C20H31N2O6+ — CID 70050915
dicyclopropyl-[4,6-dicarboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-bicyclo[3.1.0]hexanyl]-methylazanium (PubChem CID 70050915) has the molecular formula C20H31N2O6+ and a molecular weight of 395.48 g/mol. Its IUPAC name is dicyclopropyl-[4,6-dicarboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-bicyclo[3.1.0]hexanyl]-methylazanium.
| Compound Name | dicyclopropyl-[4,6-dicarboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-bicyclo[3.1.0]hexanyl]-methylazanium |
|---|---|
| PubChem CID | 70050915 |
| Molecular Formula | C20H31N2O6+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | dicyclopropyl-[4,6-dicarboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-bicyclo[3.1.0]hexanyl]-methylazanium |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)O)CC([N+](C)(C2CC2)C2CC2)C2C(C(=O)O)C21 |
| InChI | InChI=1S/C20H30N2O6/c1-19(2,3)28-18(27)21-20(17(25)26)9-12(13-14(15(13)20)16(23)24)22(4,10-5-6-10)11-7-8-11/h10-15H,5-9H2,1-4H3,(H2-,21,23,24,25,26,27)/p+1 |
| InChIKey | YIPIFSVMCIWQLO-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|