C13H18N2O8 — CID 22133225
2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrobicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 22133225) has the molecular formula C13H18N2O8 and a molecular weight of 330.29 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrobicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 22133225 |
| Molecular Formula | C13H18N2O8 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)O)CC([N+](=O)[O-])C2C(C(=O)O)C21 |
| InChI | InChI=1S/C13H18N2O8/c1-12(2,3)23-11(20)14-13(10(18)19)4-5(15(21)22)6-7(8(6)13)9(16)17/h5-8H,4H2,1-3H3,(H,14,20)(H,16,17)(H,18,19) |
| InChIKey | PELCQTKDLXSNCC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|