C20H25NO9S — CID 89203492
(1S,2S,4S,5R,6R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 89203492) has the molecular formula C20H25NO9S and a molecular weight of 455.49 g/mol. Its IUPAC name is (1S,2S,4S,5R,6R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1S,2S,4S,5R,6R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 89203492 |
| Molecular Formula | C20H25NO9S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (1S,2S,4S,5R,6R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C[C@@](NC(=O)OC(C)(C)C)(C(=O)O)[C@@H]3[C@@H](C(=O)O)[C@@H]32)cc1 |
| InChI | InChI=1S/C20H25NO9S/c1-10-5-7-11(8-6-10)31(27,28)30-12-9-20(17(24)25,15-13(12)14(15)16(22)23)21-18(26)29-19(2,3)4/h5-8,12-15H,9H2,1-4H3,(H,21,26)(H,22,23)(H,24,25)/t12-,13-,14-,15-,20-/m0/s1 |
| InChIKey | RDYQGCPUUJCECL-SLARRSDRSA-N |
| XLogP | 1.77 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|