C24H33NO9S — CID 15479120
diethyl (1S,2S,4S,5R,6R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 15479120) has the molecular formula C24H33NO9S and a molecular weight of 511.59 g/mol. Its IUPAC name is diethyl (1S,2S,4S,5R,6R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1S,2S,4S,5R,6R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 15479120 |
| Molecular Formula | C24H33NO9S |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | diethyl (1S,2S,4S,5R,6R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2[C@@H]1[C@](NC(=O)OC(C)(C)C)(C(=O)OCC)C[C@@H]2OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H33NO9S/c1-7-31-20(26)18-17-16(34-35(29,30)15-11-9-14(3)10-12-15)13-24(19(17)18,21(27)32-8-2)25-22(28)33-23(4,5)6/h9-12,16-19H,7-8,13H2,1-6H3,(H,25,28)/t16-,17-,18-,19-,24-/m0/s1 |
| InChIKey | ABOBJDARJJNMNF-XTHUUODCSA-N |
| XLogP | 2.72 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|