C28H43NO9S — CID 89304658
ditert-butyl (1S,2S,4S,5R,6R)-4-(4-methylcyclohexa-2,4-dien-1-yl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 89304658) has the molecular formula C28H43NO9S and a molecular weight of 569.72 g/mol. Its IUPAC name is ditert-butyl (1S,2S,4S,5R,6R)-4-(4-methylcyclohexa-2,4-dien-1-yl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | ditert-butyl (1S,2S,4S,5R,6R)-4-(4-methylcyclohexa-2,4-dien-1-yl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 89304658 |
| Molecular Formula | C28H43NO9S |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | ditert-butyl (1S,2S,4S,5R,6R)-4-(4-methylcyclohexa-2,4-dien-1-yl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CC1=CCC(S(=O)(=O)O[C@H]2C[C@@](NC(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)[C@@H]3[C@@H](C(=O)OC(C)(C)C)[C@@H]32)C=C1 |
| InChI | InChI=1S/C28H43NO9S/c1-16-11-13-17(14-12-16)39(33,34)38-18-15-28(23(31)36-26(5,6)7,29-24(32)37-27(8,9)10)21-19(18)20(21)22(30)35-25(2,3)4/h11-13,17-21H,14-15H2,1-10H3,(H,29,32)/t17?,18-,19-,20-,21-,28-/m0/s1 |
| InChIKey | GDAOQBFBNCCUJB-POGUIEMGSA-N |
| XLogP | 4.19 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|