C23H37NO6 — CID 86691260
ditert-butyl (1S,2S,5R,6S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[bicyclo[3.1.0]hexane-4,1'-cyclopropane]-2,6-dicarboxylate (PubChem CID 86691260) has the molecular formula C23H37NO6 and a molecular weight of 423.55 g/mol. Its IUPAC name is ditert-butyl (1S,2S,5R,6S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[bicyclo[3.1.0]hexane-4,1'-cyclopropane]-2,6-dicarboxylate.
| Compound Name | ditert-butyl (1S,2S,5R,6S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[bicyclo[3.1.0]hexane-4,1'-cyclopropane]-2,6-dicarboxylate |
|---|---|
| PubChem CID | 86691260 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | ditert-butyl (1S,2S,5R,6S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[bicyclo[3.1.0]hexane-4,1'-cyclopropane]-2,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(C(=O)OC(C)(C)C)CC2(CC2)[C@H]2[C@H](C(=O)OC(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C23H37NO6/c1-19(2,3)28-16(25)13-14-15(13)23(12-22(14)10-11-22,17(26)29-20(4,5)6)24-18(27)30-21(7,8)9/h13-15H,10-12H2,1-9H3,(H,24,27)/t13-,14-,15+,23-/m0/s1 |
| InChIKey | VBGUWEAABOMSOP-SONXGWPDSA-N |
| XLogP | 3.98 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|