C19H30N2O8 — CID 67560890
methyl 2-[(1R,2R,4S,5S,6S)-2-acetyloxy-4-hydroxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-bicyclo[3.1.0]hexanyl]acetate (PubChem CID 67560890) has the molecular formula C19H30N2O8 and a molecular weight of 414.46 g/mol. Its IUPAC name is methyl 2-[(1R,2R,4S,5S,6S)-2-acetyloxy-4-hydroxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-bicyclo[3.1.0]hexanyl]acetate.
| Compound Name | methyl 2-[(1R,2R,4S,5S,6S)-2-acetyloxy-4-hydroxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-bicyclo[3.1.0]hexanyl]acetate |
|---|---|
| PubChem CID | 67560890 |
| Molecular Formula | C19H30N2O8 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | methyl 2-[(1R,2R,4S,5S,6S)-2-acetyloxy-4-hydroxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-bicyclo[3.1.0]hexanyl]acetate |
| SMILES | COC(=O)C[C@H]1[C@H]2[C@@H]1[C@](NC(=O)[C@H](C)NC(=O)OC(C)(C)C)(OC(C)=O)C[C@@H]2O |
| InChI | InChI=1S/C19H30N2O8/c1-9(20-17(26)29-18(3,4)5)16(25)21-19(28-10(2)22)8-12(23)14-11(15(14)19)7-13(24)27-6/h9,11-12,14-15,23H,7-8H2,1-6H3,(H,20,26)(H,21,25)/t9-,11-,12-,14+,15+,19+/m0/s1 |
| InChIKey | KIWLGAZQTNSFKN-OQEFJEACSA-N |
| XLogP | 0.47 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|