C24H25NO6 — CID 102213170
1-O-ethyl 3-O-methyl (3R,5R)-5-phenyl-3-(phenylmethoxycarbonylamino)cyclopentene-1,3-dicarboxylate (PubChem CID 102213170) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl (3R,5R)-5-phenyl-3-(phenylmethoxycarbonylamino)cyclopentene-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-methyl (3R,5R)-5-phenyl-3-(phenylmethoxycarbonylamino)cyclopentene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102213170 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-O-ethyl 3-O-methyl (3R,5R)-5-phenyl-3-(phenylmethoxycarbonylamino)cyclopentene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C[C@@](NC(=O)OCc2ccccc2)(C(=O)OC)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H25NO6/c1-3-30-21(26)20-15-24(22(27)29-2,14-19(20)18-12-8-5-9-13-18)25-23(28)31-16-17-10-6-4-7-11-17/h4-13,15,19H,3,14,16H2,1-2H3,(H,25,28)/t19-,24-/m1/s1 |
| InChIKey | WMXVRFFKVHPAEZ-NTKDMRAZSA-N |
| XLogP | 3.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|