C20H18F3NO4 — CID 10363157
ethyl 2,3,5-trifluoro-4-[1-(phenylmethoxycarbonylamino)cyclopropyl]benzoate (PubChem CID 10363157) has the molecular formula C20H18F3NO4 and a molecular weight of 393.36 g/mol. Its IUPAC name is ethyl 2,3,5-trifluoro-4-[1-(phenylmethoxycarbonylamino)cyclopropyl]benzoate.
| Compound Name | ethyl 2,3,5-trifluoro-4-[1-(phenylmethoxycarbonylamino)cyclopropyl]benzoate |
|---|---|
| PubChem CID | 10363157 |
| Molecular Formula | C20H18F3NO4 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | ethyl 2,3,5-trifluoro-4-[1-(phenylmethoxycarbonylamino)cyclopropyl]benzoate |
| SMILES | CCOC(=O)c1cc(F)c(C2(NC(=O)OCc3ccccc3)CC2)c(F)c1F |
| InChI | InChI=1S/C20H18F3NO4/c1-2-27-18(25)13-10-14(21)15(17(23)16(13)22)20(8-9-20)24-19(26)28-11-12-6-4-3-5-7-12/h3-7,10H,2,8-9,11H2,1H3,(H,24,26) |
| InChIKey | UZBHJJXQTLEZMP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|