C18H18N2O3 — CID 143923916
benzyl N-(1-carbamoyl-2-phenylcyclopropyl)carbamate (PubChem CID 143923916) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is benzyl N-(1-carbamoyl-2-phenylcyclopropyl)carbamate.
| Compound Name | benzyl N-(1-carbamoyl-2-phenylcyclopropyl)carbamate |
|---|---|
| PubChem CID | 143923916 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | benzyl N-(1-carbamoyl-2-phenylcyclopropyl)carbamate |
| SMILES | NC(=O)C1(NC(=O)OCc2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c19-16(21)18(11-15(18)14-9-5-2-6-10-14)20-17(22)23-12-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H2,19,21)(H,20,22) |
| InChIKey | FQQBYAMDBNKFIR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |