C25H24N2O6 — CID 102097797
dimethyl 4-benzamido-5-(furan-2-yl)-3-phenylpyrrolidine-2,4-dicarboxylate (PubChem CID 102097797) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is dimethyl 4-benzamido-5-(furan-2-yl)-3-phenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl 4-benzamido-5-(furan-2-yl)-3-phenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 102097797 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | dimethyl 4-benzamido-5-(furan-2-yl)-3-phenylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)C1NC(c2ccco2)C(NC(=O)c2ccccc2)(C(=O)OC)C1c1ccccc1 |
| InChI | InChI=1S/C25H24N2O6/c1-31-23(29)20-19(16-10-5-3-6-11-16)25(24(30)32-2,21(26-20)18-14-9-15-33-18)27-22(28)17-12-7-4-8-13-17/h3-15,19-21,26H,1-2H3,(H,27,28) |
| InChIKey | XJGVNGKRMULIII-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |