C13H14O3 — CID 99945900
(1R,2R,3S,5S,7R,8R)-2-propanoyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one (PubChem CID 99945900) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1R,2R,3S,5S,7R,8R)-2-propanoyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one.
| Compound Name | (1R,2R,3S,5S,7R,8R)-2-propanoyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one |
|---|---|
| PubChem CID | 99945900 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1R,2R,3S,5S,7R,8R)-2-propanoyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-en-6-one |
| SMILES | CCC(=O)[C@@]12[C@@H]3O[C@@H]3C(=O)[C@@H]1[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C13H14O3/c1-2-8(14)13-7-4-3-6(5-7)9(13)10(15)11-12(13)16-11/h3-4,6-7,9,11-12H,2,5H2,1H3/t6-,7-,9-,11+,12+,13+/m0/s1 |
| InChIKey | AQVFGRJXNKXYLX-WZBNZFBESA-N |
| XLogP | 1.12 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|