C21H24O5 — CID 101044945
1-[(1S,2S,3S,5R,8R,10S,11S,12R)-10-methoxy-5-phenyl-4,6,9-trioxatetracyclo[10.2.1.02,11.03,8]pentadec-13-en-2-yl]ethanone (PubChem CID 101044945) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[(1S,2S,3S,5R,8R,10S,11S,12R)-10-methoxy-5-phenyl-4,6,9-trioxatetracyclo[10.2.1.02,11.03,8]pentadec-13-en-2-yl]ethanone.
| Compound Name | 1-[(1S,2S,3S,5R,8R,10S,11S,12R)-10-methoxy-5-phenyl-4,6,9-trioxatetracyclo[10.2.1.02,11.03,8]pentadec-13-en-2-yl]ethanone |
|---|---|
| PubChem CID | 101044945 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[(1S,2S,3S,5R,8R,10S,11S,12R)-10-methoxy-5-phenyl-4,6,9-trioxatetracyclo[10.2.1.02,11.03,8]pentadec-13-en-2-yl]ethanone |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@]2(C(C)=O)[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C21H24O5/c1-12(22)21-15-9-8-14(10-15)17(21)20(23-2)25-16-11-24-19(26-18(16)21)13-6-4-3-5-7-13/h3-9,14-20H,10-11H2,1-2H3/t14-,15+,16+,17+,18+,19+,20-,21+/m0/s1 |
| InChIKey | SSZBBDCNHPKJAR-YWFCDVSRSA-N |
| XLogP | 2.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|