About 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione
3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione (PubChem CID 85125810) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione.
Analyze 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione?
The IUPAC name of 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione (CID 85125810) is 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione.
What is the SMILES notation for 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione?
The canonical SMILES for 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione is CC1C=CC(=O)C2C(C)C(=O)CC12.
What is the InChIKey of 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione?
The InChIKey is AENWPIVERQRQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-6-3-4-9(12)11-7(2)10(13)5-8(6)11/h3-4,6-8,11H,5H2,1-2H3.
What are the key properties of 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione?
3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione has a molecular weight of 178.23 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-3,3a,7,7a-tetrahydro-1H-indene-2,4-dione is sourced from PubChem (CID 85125810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).