C13H21NO2 — CID 91005858
ethane;4-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;tritiomethane (PubChem CID 91005858) has the molecular formula C13H21NO2 and a molecular weight of 225.32 g/mol. Its IUPAC name is ethane;4-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;tritiomethane.
| Compound Name | ethane;4-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;tritiomethane |
|---|---|
| PubChem CID | 91005858 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethane;4-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;tritiomethane |
| SMILES | CC.CN1C(=O)C2C3C=CC(C3)C2C1=O.[3H]C |
| InChI | InChI=1S/C10H11NO2.C2H6.CH4/c1-11-9(12)7-5-2-3-6(4-5)8(7)10(11)13;1-2;/h2-3,5-8H,4H2,1H3;1-2H3;1H4/i;;1T |
| InChIKey | IJIBYAWTIWKWAJ-ZDNREJLISA-N |
| XLogP | 2.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|