C15H17NO5 — CID 159965484
4-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;3-methyloxolane-2,5-dione (PubChem CID 159965484) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;3-methyloxolane-2,5-dione.
| Compound Name | 4-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;3-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 159965484 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;3-methyloxolane-2,5-dione |
| SMILES | CC1CC(=O)OC1=O.CN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C10H11NO2.C5H6O3/c1-11-9(12)7-5-2-3-6(4-5)8(7)10(11)13;1-3-2-4(6)8-5(3)7/h2-3,5-8H,4H2,1H3;3H,2H2,1H3 |
| InChIKey | ODWKILPOMWTFMT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|