C13H22O3 — CID 159354457
ethane;methane;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 159354457) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;methane;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | ethane;methane;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 159354457 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | ethane;methane;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C.C.CC.O=C1OC(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C9H8O3.C2H6.2CH4/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8;1-2;;/h1-2,4-7H,3H2;1-2H3;2*1H4 |
| InChIKey | LHTCTYMWWJPXQM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|