C13H12O5 — CID 159999281
2H-furan-5-one;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 159999281) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 2H-furan-5-one;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 2H-furan-5-one;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 159999281 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2H-furan-5-one;4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C=CCO1.O=C1OC(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C9H8O3.C4H4O2/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8;5-4-2-1-3-6-4/h1-2,4-7H,3H2;1-2H,3H2 |
| InChIKey | OHYLZOIPYZXJKV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|