C13H14O4 — CID 45139735
(1R,2R,8S,10R)-4,14-dioxatricyclo[8.5.0.02,8]pentadeca-6,11-diene-3,15-dione (PubChem CID 45139735) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (1R,2R,8S,10R)-4,14-dioxatricyclo[8.5.0.02,8]pentadeca-6,11-diene-3,15-dione.
| Compound Name | (1R,2R,8S,10R)-4,14-dioxatricyclo[8.5.0.02,8]pentadeca-6,11-diene-3,15-dione |
|---|---|
| PubChem CID | 45139735 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (1R,2R,8S,10R)-4,14-dioxatricyclo[8.5.0.02,8]pentadeca-6,11-diene-3,15-dione |
| SMILES | O=C1OCC=C[C@@H]2C[C@@H]3C=CCOC(=O)[C@H]3[C@H]12 |
| InChI | InChI=1S/C13H14O4/c14-12-10-8(3-1-5-16-12)7-9-4-2-6-17-13(15)11(9)10/h1-4,8-11H,5-7H2/t8-,9+,10-,11-/m1/s1 |
| InChIKey | JMMFKMUYUXSABE-LMLFDSFASA-N |
| XLogP | 1.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|